About 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide
2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide (PubChem CID 172691698) has the molecular formula C17H16Br2N2
and a molecular weight of 408.14 g/mol. Its IUPAC name is 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide.
Molecular Properties
| Compound Name | 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide |
| PubChem CID | 172691698 |
| Molecular Formula | C17H16Br2N2 |
| Molecular Weight | 408.14 g/mol |
| Exact Mass | 405.97 |
| IUPAC Name | 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide |
| SMILES | Br.Br.c1ccc(Cc2cc(-c3ccncc3)ccn2)cc1 |
| InChI | InChI=1S/C17H14N2.2BrH/c1-2-4-14(5-3-1)12-17-13-16(8-11-19-17)15-6-9-18-10-7-15;;/h1-11,13H,12H2;2*1H |
| InChIKey | BTNXLVZJSMSJOV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.14 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide?
The IUPAC name of 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide (CID 172691698) is 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide.
What is the SMILES notation for 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide?
The canonical SMILES for 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide is Br.Br.c1ccc(Cc2cc(-c3ccncc3)ccn2)cc1.
What is the InChIKey of 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide?
The InChIKey is BTNXLVZJSMSJOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2.2BrH/c1-2-4-14(5-3-1)12-17-13-16(8-11-19-17)15-6-9-18-10-7-15;;/h1-11,13H,12H2;2*1H.
What are the key properties of 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide?
2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide has a molecular weight of 408.14 g/mol, XLogP of 4.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4-pyridin-4-ylpyridine;dihydrobromide is sourced from PubChem (CID 172691698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).