1-chloro-3-(3-chloropropoxy)propane;nitric acid

C6H13Cl2NO4 — CID 172696075

IUPAC1-chloro-3-(3-chloropropoxy)propane;nitric acid
SMILESClCCCOCCCCl.O=[N+]([O-])O
InChIInChI=1S/C6H12Cl2O.HNO3/c7-3-1-5-9-6-2-4-8;2-1(3)4/h1-6H2;(H,2,3,4)
InChIKeyCIKPPNADEIZQMA-UHFFFAOYSA-N
MW234.08 g/mol
LogP1.91
Rot. Bonds6

About 1-chloro-3-(3-chloropropoxy)propane;nitric acid

1-chloro-3-(3-chloropropoxy)propane;nitric acid (PubChem CID 172696075) has the molecular formula C6H13Cl2NO4 and a molecular weight of 234.08 g/mol. Its IUPAC name is 1-chloro-3-(3-chloropropoxy)propane;nitric acid.

Molecular Properties

Compound Name1-chloro-3-(3-chloropropoxy)propane;nitric acid
PubChem CID172696075
Molecular FormulaC6H13Cl2NO4
Molecular Weight234.08 g/mol
Exact Mass233.02
IUPAC Name1-chloro-3-(3-chloropropoxy)propane;nitric acid
SMILESClCCCOCCCCl.O=[N+]([O-])O
InChIInChI=1S/C6H12Cl2O.HNO3/c7-3-1-5-9-6-2-4-8;2-1(3)4/h1-6H2;(H,2,3,4)
InChIKeyCIKPPNADEIZQMA-UHFFFAOYSA-N
XLogP1.91
TPSA72.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.08
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-chloro-3-(3-chloropropoxy)propane;nitric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-chloro-3-(3-chloropropoxy)propane;nitric acid?
The IUPAC name of 1-chloro-3-(3-chloropropoxy)propane;nitric acid (CID 172696075) is 1-chloro-3-(3-chloropropoxy)propane;nitric acid.
What is the SMILES notation for 1-chloro-3-(3-chloropropoxy)propane;nitric acid?
The canonical SMILES for 1-chloro-3-(3-chloropropoxy)propane;nitric acid is ClCCCOCCCCl.O=[N+]([O-])O.
What is the InChIKey of 1-chloro-3-(3-chloropropoxy)propane;nitric acid?
The InChIKey is CIKPPNADEIZQMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Cl2O.HNO3/c7-3-1-5-9-6-2-4-8;2-1(3)4/h1-6H2;(H,2,3,4).
What are the key properties of 1-chloro-3-(3-chloropropoxy)propane;nitric acid?
1-chloro-3-(3-chloropropoxy)propane;nitric acid has a molecular weight of 234.08 g/mol, XLogP of 1.91, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-(3-chloropropoxy)propane;nitric acid is sourced from PubChem (CID 172696075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).