methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate

C15H26O4 — CID 172697432

IUPACmethyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate
SMILESCCCCCC1CC2(CC1CC(=O)OC)OCCO2
InChIInChI=1S/C15H26O4/c1-3-4-5-6-12-10-15(18-7-8-19-15)11-13(12)9-14(16)17-2/h12-13H,3-11H2,1-2H3
InChIKeyCMTUFCNSMXMMII-UHFFFAOYSA-N
MW270.37 g/mol
LogP2.90
Rot. Bonds6

About methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate

methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate (PubChem CID 172697432) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate.

Molecular Properties

Compound Namemethyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate
PubChem CID172697432
Molecular FormulaC15H26O4
Molecular Weight270.37 g/mol
Exact Mass270.18
IUPAC Namemethyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate
SMILESCCCCCC1CC2(CC1CC(=O)OC)OCCO2
InChIInChI=1S/C15H26O4/c1-3-4-5-6-12-10-15(18-7-8-19-15)11-13(12)9-14(16)17-2/h12-13H,3-11H2,1-2H3
InChIKeyCMTUFCNSMXMMII-UHFFFAOYSA-N
XLogP2.90
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.37
LogP ≤ 52.90
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate?
The IUPAC name of methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate (CID 172697432) is methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate.
What is the SMILES notation for methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate?
The canonical SMILES for methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate is CCCCCC1CC2(CC1CC(=O)OC)OCCO2.
What is the InChIKey of methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate?
The InChIKey is CMTUFCNSMXMMII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26O4/c1-3-4-5-6-12-10-15(18-7-8-19-15)11-13(12)9-14(16)17-2/h12-13H,3-11H2,1-2H3.
What are the key properties of methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate?
methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate has a molecular weight of 270.37 g/mol, XLogP of 2.90, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(7-pentyl-1,4-dioxaspiro[4.4]nonan-8-yl)acetate is sourced from PubChem (CID 172697432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).