About 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine
4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine (PubChem CID 172698370) has the molecular formula C8H10BrF3N2
and a molecular weight of 271.08 g/mol. Its IUPAC name is 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine.
Molecular Properties
| Compound Name | 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine |
| PubChem CID | 172698370 |
| Molecular Formula | C8H10BrF3N2 |
| Molecular Weight | 271.08 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine |
| SMILES | CNC1(C)NC=CC(Br)=C1C(F)(F)F |
| InChI | InChI=1S/C8H10BrF3N2/c1-7(13-2)6(8(10,11)12)5(9)3-4-14-7/h3-4,13-14H,1-2H3 |
| InChIKey | CPXJINHIBPIWMO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.08 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine?
The IUPAC name of 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine (CID 172698370) is 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine.
What is the SMILES notation for 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine?
The canonical SMILES for 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine is CNC1(C)NC=CC(Br)=C1C(F)(F)F.
What is the InChIKey of 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine?
The InChIKey is CPXJINHIBPIWMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrF3N2/c1-7(13-2)6(8(10,11)12)5(9)3-4-14-7/h3-4,13-14H,1-2H3.
What are the key properties of 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine?
4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine has a molecular weight of 271.08 g/mol, XLogP of 2.25, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,2-dimethyl-3-(trifluoromethyl)-1H-pyridin-2-amine is sourced from PubChem (CID 172698370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).