C28H21N5O2S — CID 172699547
1-benzyl-3-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]thiourea (PubChem CID 172699547) has the molecular formula C28H21N5O2S and a molecular weight of 491.58 g/mol. Its IUPAC name is 1-benzyl-3-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]thiourea.
| Compound Name | 1-benzyl-3-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]thiourea |
|---|---|
| PubChem CID | 172699547 |
| Molecular Formula | C28H21N5O2S |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.14 |
| IUPAC Name | 1-benzyl-3-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]thiourea |
| SMILES | O=C1C(c2c[nH]c3ccccc23)=C(c2c[nH]c3ccccc23)C(=O)N1NC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C28H21N5O2S/c34-26-24(20-15-29-22-12-6-4-10-18(20)22)25(21-16-30-23-13-7-5-11-19(21)23)27(35)33(26)32-28(36)31-14-17-8-2-1-3-9-17/h1-13,15-16,29-30H,14H2,(H2,31,32,36) |
| InChIKey | CTWMNSNCRYOHKT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|