C27H18ClN5O2S — CID 172803954
1-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]-3-(3-chlorophenyl)thiourea (PubChem CID 172803954) has the molecular formula C27H18ClN5O2S and a molecular weight of 511.99 g/mol. Its IUPAC name is 1-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 172803954 |
| Molecular Formula | C27H18ClN5O2S |
| Molecular Weight | 511.99 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | 1-[3,4-bis(1H-indol-3-yl)-2,5-dioxopyrrol-1-yl]-3-(3-chlorophenyl)thiourea |
| SMILES | O=C1C(c2c[nH]c3ccccc23)=C(c2c[nH]c3ccccc23)C(=O)N1NC(=S)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C27H18ClN5O2S/c28-15-6-5-7-16(12-15)31-27(36)32-33-25(34)23(19-13-29-21-10-3-1-8-17(19)21)24(26(33)35)20-14-30-22-11-4-2-9-18(20)22/h1-14,29-30H,(H2,31,32,36) |
| InChIKey | RGALWABXPZREER-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.99 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|