C21H27Cl5N3OS+ — CID 172701057
[3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propylsulfanyl-hydroxymethylidene]-(3,4-dichlorophenyl)azanium;dihydrochloride (PubChem CID 172701057) has the molecular formula C21H27Cl5N3OS+ and a molecular weight of 546.80 g/mol. Its IUPAC name is [3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propylsulfanyl-hydroxymethylidene]-(3,4-dichlorophenyl)azanium;dihydrochloride.
| Compound Name | [3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propylsulfanyl-hydroxymethylidene]-(3,4-dichlorophenyl)azanium;dihydrochloride |
|---|---|
| PubChem CID | 172701057 |
| Molecular Formula | C21H27Cl5N3OS+ |
| Molecular Weight | 546.80 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | [3-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]propylsulfanyl-hydroxymethylidene]-(3,4-dichlorophenyl)azanium;dihydrochloride |
| SMILES | Cl.Cl.O/C(=[NH+]\c1ccc(Cl)c(Cl)c1)SCCCN1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C21H24Cl3N3OS.2ClH/c22-17-4-2-16(3-5-17)15-27-11-9-26(10-12-27)8-1-13-29-21(28)25-18-6-7-19(23)20(24)14-18;;/h2-7,14H,1,8-13,15H2,(H,25,28);2*1H/p+1 |
| InChIKey | GAAGZVGMAJQBMP-UHFFFAOYSA-O |
| XLogP | 5.06 |
| TPSA | 40.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.80 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|