C29H50O3 — CID 172702658
(5-tert-butyl-3-ethyl-2,2-dimethyltetradecan-4-yl) 2-hydroxybenzoate (PubChem CID 172702658) has the molecular formula C29H50O3 and a molecular weight of 446.72 g/mol. Its IUPAC name is (5-tert-butyl-3-ethyl-2,2-dimethyltetradecan-4-yl) 2-hydroxybenzoate.
| Compound Name | (5-tert-butyl-3-ethyl-2,2-dimethyltetradecan-4-yl) 2-hydroxybenzoate |
|---|---|
| PubChem CID | 172702658 |
| Molecular Formula | C29H50O3 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | (5-tert-butyl-3-ethyl-2,2-dimethyltetradecan-4-yl) 2-hydroxybenzoate |
| SMILES | CCCCCCCCCC(C(OC(=O)c1ccccc1O)C(CC)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C29H50O3/c1-9-11-12-13-14-15-16-20-24(29(6,7)8)26(23(10-2)28(3,4)5)32-27(31)22-19-17-18-21-25(22)30/h17-19,21,23-24,26,30H,9-16,20H2,1-8H3 |
| InChIKey | DEBDNGRRRIYDKX-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|