C10H22NNa2O3S2+ — CID 172702866
disodium;[dioxido(oxo)-λ6-sulfanylidene]-[9-(methylamino)nonyl]sulfanium (PubChem CID 172702866) has the molecular formula C10H22NNa2O3S2+ and a molecular weight of 314.40 g/mol. Its IUPAC name is disodium;[dioxido(oxo)-λ6-sulfanylidene]-[9-(methylamino)nonyl]sulfanium.
| Compound Name | disodium;[dioxido(oxo)-λ6-sulfanylidene]-[9-(methylamino)nonyl]sulfanium |
|---|---|
| PubChem CID | 172702866 |
| Molecular Formula | C10H22NNa2O3S2+ |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | disodium;[dioxido(oxo)-λ6-sulfanylidene]-[9-(methylamino)nonyl]sulfanium |
| SMILES | CNCCCCCCCCC[S+]=S(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C10H23NO3S2.2Na/c1-11-9-7-5-3-2-4-6-8-10-15-16(12,13)14;;/h11H,2-10H2,1H3,(H-,12,13,14);;/q;2*+1/p-1 |
| InChIKey | DESWHFFUUSWLCT-UHFFFAOYSA-M |
| XLogP | -4.51 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | -4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|