About disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium
disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium (PubChem CID 172716474) has the molecular formula C7H16NNa2O3S2+
and a molecular weight of 272.32 g/mol. Its IUPAC name is disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium.
Molecular Properties
| Compound Name | disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium |
| PubChem CID | 172716474 |
| Molecular Formula | C7H16NNa2O3S2+ |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium |
| SMILES | CN(C)CCCCC[S+]=S(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C7H17NO3S2.2Na/c1-8(2)6-4-3-5-7-12-13(9,10)11;;/h3-7H2,1-2H3,(H-,9,10,11);;/q;2*+1/p-1 |
| InChIKey | FXVGWKTWMQBYSD-UHFFFAOYSA-M |
| XLogP | -5.73 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | -5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium?
The IUPAC name of disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium (CID 172716474) is disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium.
What is the SMILES notation for disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium?
The canonical SMILES for disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium is CN(C)CCCCC[S+]=S(=O)([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium?
The InChIKey is FXVGWKTWMQBYSD-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H17NO3S2.2Na/c1-8(2)6-4-3-5-7-12-13(9,10)11;;/h3-7H2,1-2H3,(H-,9,10,11);;/q;2*+1/p-1.
What are the key properties of disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium?
disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium has a molecular weight of 272.32 g/mol, XLogP of -5.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;5-(dimethylamino)pentyl-[dioxido(oxo)-λ6-sulfanylidene]sulfanium is sourced from PubChem (CID 172716474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).