C23H26ClNOS — CID 172703596
(8R)-2-tert-butyl-8-(chloromethyl)-1-methyl-4-phenylmethoxy-7,8-dihydro-6H-thieno[3,2-e]indole (PubChem CID 172703596) has the molecular formula C23H26ClNOS and a molecular weight of 399.99 g/mol. Its IUPAC name is (8R)-2-tert-butyl-8-(chloromethyl)-1-methyl-4-phenylmethoxy-7,8-dihydro-6H-thieno[3,2-e]indole.
| Compound Name | (8R)-2-tert-butyl-8-(chloromethyl)-1-methyl-4-phenylmethoxy-7,8-dihydro-6H-thieno[3,2-e]indole |
|---|---|
| PubChem CID | 172703596 |
| Molecular Formula | C23H26ClNOS |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (8R)-2-tert-butyl-8-(chloromethyl)-1-methyl-4-phenylmethoxy-7,8-dihydro-6H-thieno[3,2-e]indole |
| SMILES | Cc1c(C(C)(C)C)sc2c(OCc3ccccc3)cc3c(c12)[C@@H](CCl)CN3 |
| InChI | InChI=1S/C23H26ClNOS/c1-14-19-20-16(11-24)12-25-17(20)10-18(21(19)27-22(14)23(2,3)4)26-13-15-8-6-5-7-9-15/h5-10,16,25H,11-13H2,1-4H3/t16-/m0/s1 |
| InChIKey | DHDLWLHQGASMNX-INIZCTEOSA-N |
| XLogP | 6.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|