C20H21ClN2O — CID 144891951
(8S)-8-(chloromethyl)-1,6-dimethyl-4-phenylmethoxy-7,8-dihydro-3H-pyrrolo[3,2-e]indole (PubChem CID 144891951) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is (8S)-8-(chloromethyl)-1,6-dimethyl-4-phenylmethoxy-7,8-dihydro-3H-pyrrolo[3,2-e]indole.
| Compound Name | (8S)-8-(chloromethyl)-1,6-dimethyl-4-phenylmethoxy-7,8-dihydro-3H-pyrrolo[3,2-e]indole |
|---|---|
| PubChem CID | 144891951 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (8S)-8-(chloromethyl)-1,6-dimethyl-4-phenylmethoxy-7,8-dihydro-3H-pyrrolo[3,2-e]indole |
| SMILES | Cc1c[nH]c2c(OCc3ccccc3)cc3c(c12)[C@H](CCl)CN3C |
| InChI | InChI=1S/C20H21ClN2O/c1-13-10-22-20-17(24-12-14-6-4-3-5-7-14)8-16-19(18(13)20)15(9-21)11-23(16)2/h3-8,10,15,22H,9,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | WKKNGZPEQACKCW-OAHLLOKOSA-N |
| XLogP | 4.83 |
| TPSA | 28.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|