C21H27N3O4 — CID 172703620
3-deuterio-3-[6-[[(2R)-1-ethylpiperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 172703620) has the molecular formula C21H27N3O4 and a molecular weight of 386.47 g/mol. Its IUPAC name is 3-deuterio-3-[6-[[(2R)-1-ethylpiperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-deuterio-3-[6-[[(2R)-1-ethylpiperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 172703620 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-deuterio-3-[6-[[(2R)-1-ethylpiperidin-2-yl]methoxy]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1(N2Cc3cc(OC[C@H]4CCCCN4CC)ccc3C2=O)CCC(=O)NC1=O |
| InChI | InChI=1S/C21H27N3O4/c1-2-23-10-4-3-5-15(23)13-28-16-6-7-17-14(11-16)12-24(21(17)27)18-8-9-19(25)22-20(18)26/h6-7,11,15,18H,2-5,8-10,12-13H2,1H3,(H,22,25,26)/t15-,18?/m1/s1/i18D |
| InChIKey | DHFJHVJOMHNTSK-KEVRRSAQSA-N |
| XLogP | 1.70 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|