C20H19Cl2N5O2S — CID 17270538
2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 17270538) has the molecular formula C20H19Cl2N5O2S and a molecular weight of 464.38 g/mol. Its IUPAC name is 2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 17270538 |
| Molecular Formula | C20H19Cl2N5O2S |
| Molecular Weight | 464.38 g/mol |
| Exact Mass | 463.06 |
| IUPAC Name | 2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccnc2Cl)nnc1C(C)Oc1ccccc1Cl |
| InChI | InChI=1S/C20H19Cl2N5O2S/c1-3-11-27-19(13(2)29-16-9-5-4-7-14(16)21)25-26-20(27)30-12-17(28)24-15-8-6-10-23-18(15)22/h3-10,13H,1,11-12H2,2H3,(H,24,28) |
| InChIKey | XOPDPTILCYOHAX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|