C22H20ClN5O2S — CID 43884747
2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanophenyl)acetamide (PubChem CID 43884747) has the molecular formula C22H20ClN5O2S and a molecular weight of 453.96 g/mol. Its IUPAC name is 2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanophenyl)acetamide.
| Compound Name | 2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 43884747 |
| Molecular Formula | C22H20ClN5O2S |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | 2-[[5-[1-(2-chlorophenoxy)ethyl]-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanophenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2C#N)nnc1C(C)Oc1ccccc1Cl |
| InChI | InChI=1S/C22H20ClN5O2S/c1-3-12-28-21(15(2)30-19-11-7-5-9-17(19)23)26-27-22(28)31-14-20(29)25-18-10-6-4-8-16(18)13-24/h3-11,15H,1,12,14H2,2H3,(H,25,29) |
| InChIKey | WHZDUPLXBRUVIB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|