C7H19NaO8P2 — CID 172707901
sodium;dihydrogen phosphate;heptyl dihydrogen phosphate (PubChem CID 172707901) has the molecular formula C7H19NaO8P2 and a molecular weight of 316.16 g/mol. Its IUPAC name is sodium;dihydrogen phosphate;heptyl dihydrogen phosphate.
| Compound Name | sodium;dihydrogen phosphate;heptyl dihydrogen phosphate |
|---|---|
| PubChem CID | 172707901 |
| Molecular Formula | C7H19NaO8P2 |
| Molecular Weight | 316.16 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | sodium;dihydrogen phosphate;heptyl dihydrogen phosphate |
| SMILES | CCCCCCCOP(=O)(O)O.O=P([O-])(O)O.[Na+] |
| InChI | InChI=1S/C7H17O4P.Na.H3O4P/c1-2-3-4-5-6-7-11-12(8,9)10;;1-5(2,3)4/h2-7H2,1H3,(H2,8,9,10);;(H3,1,2,3,4)/q;+1;/p-1 |
| InChIKey | DVRVCSHHLIRRMK-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 147.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.16 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|