C26H57N3O2 — CID 172710538
N'-[3-(dimethylamino)propyl]propane-1,3-diamine;octadecanoic acid (PubChem CID 172710538) has the molecular formula C26H57N3O2 and a molecular weight of 443.76 g/mol. Its IUPAC name is N'-[3-(dimethylamino)propyl]propane-1,3-diamine;octadecanoic acid.
| Compound Name | N'-[3-(dimethylamino)propyl]propane-1,3-diamine;octadecanoic acid |
|---|---|
| PubChem CID | 172710538 |
| Molecular Formula | C26H57N3O2 |
| Molecular Weight | 443.76 g/mol |
| Exact Mass | 443.45 |
| IUPAC Name | N'-[3-(dimethylamino)propyl]propane-1,3-diamine;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CN(C)CCCNCCCN |
| InChI | InChI=1S/C18H36O2.C8H21N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-11(2)8-4-7-10-6-3-5-9/h2-17H2,1H3,(H,19,20);10H,3-9H2,1-2H3 |
| InChIKey | FENCZEVQVGWZJE-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.76 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|