C27H34Cl3FN2O2 — CID 172715278
tert-butyl (2R,3R,4S,5S)-4-(aminomethyl)-4-(4-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate (PubChem CID 172715278) has the molecular formula C27H34Cl3FN2O2 and a molecular weight of 543.94 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S,5S)-4-(aminomethyl)-4-(4-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate.
| Compound Name | tert-butyl (2R,3R,4S,5S)-4-(aminomethyl)-4-(4-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 172715278 |
| Molecular Formula | C27H34Cl3FN2O2 |
| Molecular Weight | 543.94 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | tert-butyl (2R,3R,4S,5S)-4-(aminomethyl)-4-(4-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)OC(C)(C)C)[C@@H](c2cccc(Cl)c2Cl)[C@@]1(CN)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C27H34Cl3FN2O2/c1-25(2,3)13-20-27(14-32,17-11-10-15(28)12-19(17)31)21(16-8-7-9-18(29)22(16)30)23(33-20)24(34)35-26(4,5)6/h7-12,20-21,23,33H,13-14,32H2,1-6H3/t20-,21+,23+,27-/m0/s1 |
| InChIKey | FTYCNNGIRMVCON-YBMQWUKTSA-N |
| XLogP | 6.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.94 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |