C32H35Cl3FN3O4 — CID 172746700
methyl 4-[[(2R,3R,4S,5S)-4-(aminomethyl)-4-(4-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate (PubChem CID 172746700) has the molecular formula C32H35Cl3FN3O4 and a molecular weight of 651.01 g/mol. Its IUPAC name is methyl 4-[[(2R,3R,4S,5S)-4-(aminomethyl)-4-(4-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate.
| Compound Name | methyl 4-[[(2R,3R,4S,5S)-4-(aminomethyl)-4-(4-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate |
|---|---|
| PubChem CID | 172746700 |
| Molecular Formula | C32H35Cl3FN3O4 |
| Molecular Weight | 651.01 g/mol |
| Exact Mass | 649.17 |
| IUPAC Name | methyl 4-[[(2R,3R,4S,5S)-4-(aminomethyl)-4-(4-chloro-2-fluorophenyl)-3-(2,3-dichlorophenyl)-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]-3-methoxybenzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@@H]2N[C@@H](CC(C)(C)C)[C@](CN)(c3ccc(Cl)cc3F)[C@@H]2c2cccc(Cl)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C32H35Cl3FN3O4/c1-31(2,3)15-25-32(16-37,20-11-10-18(33)14-22(20)36)26(19-7-6-8-21(34)27(19)35)28(39-25)29(40)38-23-12-9-17(30(41)43-5)13-24(23)42-4/h6-14,25-26,28,39H,15-16,37H2,1-5H3,(H,38,40)/t25-,26+,28+,32-/m0/s1 |
| InChIKey | JUYLXOZNLAFHMO-NADSYKDBSA-N |
| XLogP | 6.98 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.01 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |