About 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide
5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide (PubChem CID 172715291) has the molecular formula C14H20IN3O
and a molecular weight of 373.24 g/mol. Its IUPAC name is 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide.
Molecular Properties
| Compound Name | 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide |
| PubChem CID | 172715291 |
| Molecular Formula | C14H20IN3O |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide |
| SMILES | Cc1cc(C)c2oc(N3CCN(C)CC3)nc2c1.I |
| InChI | InChI=1S/C14H19N3O.HI/c1-10-8-11(2)13-12(9-10)15-14(18-13)17-6-4-16(3)5-7-17;/h8-9H,4-7H2,1-3H3;1H |
| InChIKey | FTYPKGGPAJUDIF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide?
The IUPAC name of 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide (CID 172715291) is 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide.
What is the SMILES notation for 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide?
The canonical SMILES for 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide is Cc1cc(C)c2oc(N3CCN(C)CC3)nc2c1.I.
What is the InChIKey of 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide?
The InChIKey is FTYPKGGPAJUDIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O.HI/c1-10-8-11(2)13-12(9-10)15-14(18-13)17-6-4-16(3)5-7-17;/h8-9H,4-7H2,1-3H3;1H.
What are the key properties of 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide?
5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide has a molecular weight of 373.24 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2-(4-methylpiperazin-1-yl)-1,3-benzoxazole;hydroiodide is sourced from PubChem (CID 172715291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).