C12H8ClF5N2O2 — CID 172715553
ethyl 7-chloro-4-(difluoromethyl)-3-(trifluoromethyl)pyrazolo[1,5-a]pyridine-2-carboxylate (PubChem CID 172715553) has the molecular formula C12H8ClF5N2O2 and a molecular weight of 342.65 g/mol. Its IUPAC name is ethyl 7-chloro-4-(difluoromethyl)-3-(trifluoromethyl)pyrazolo[1,5-a]pyridine-2-carboxylate.
| Compound Name | ethyl 7-chloro-4-(difluoromethyl)-3-(trifluoromethyl)pyrazolo[1,5-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 172715553 |
| Molecular Formula | C12H8ClF5N2O2 |
| Molecular Weight | 342.65 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | ethyl 7-chloro-4-(difluoromethyl)-3-(trifluoromethyl)pyrazolo[1,5-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nn2c(Cl)ccc(C(F)F)c2c1C(F)(F)F |
| InChI | InChI=1S/C12H8ClF5N2O2/c1-2-22-11(21)8-7(12(16,17)18)9-5(10(14)15)3-4-6(13)20(9)19-8/h3-4,10H,2H2,1H3 |
| InChIKey | FUUNPYMTPUKVHZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.65 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|