C19H13ClF2N2O2 — CID 172717976
2-chloro-3,6-difluoro-N-[[4-(2-oxo-1-pyridinyl)phenyl]methyl]benzamide (PubChem CID 172717976) has the molecular formula C19H13ClF2N2O2 and a molecular weight of 374.77 g/mol. Its IUPAC name is 2-chloro-3,6-difluoro-N-[[4-(2-oxo-1-pyridinyl)phenyl]methyl]benzamide.
| Compound Name | 2-chloro-3,6-difluoro-N-[[4-(2-oxo-1-pyridinyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 172717976 |
| Molecular Formula | C19H13ClF2N2O2 |
| Molecular Weight | 374.77 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 2-chloro-3,6-difluoro-N-[[4-(2-oxo-1-pyridinyl)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1ccc(-n2ccccc2=O)cc1)c1c(F)ccc(F)c1Cl |
| InChI | InChI=1S/C19H13ClF2N2O2/c20-18-15(22)9-8-14(21)17(18)19(26)23-11-12-4-6-13(7-5-12)24-10-2-1-3-16(24)25/h1-10H,11H2,(H,23,26) |
| InChIKey | GCUHWVCHDQSKFR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.77 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|