About potassium;iodate;hydrate
potassium;iodate;hydrate (PubChem CID 172718603) has the molecular formula H2IKO4
and a molecular weight of 232.01 g/mol. Its IUPAC name is potassium;iodate;hydrate.
Molecular Properties
| Compound Name | potassium;iodate;hydrate |
| PubChem CID | 172718603 |
| Molecular Formula | H2IKO4 |
| Molecular Weight | 232.01 g/mol |
| Exact Mass | 231.86 |
| IUPAC Name | potassium;iodate;hydrate |
| SMILES | O.[K+].[O-][I+2]([O-])[O-] |
| InChI | InChI=1S/IO3.K.H2O/c2-1(3)4;;/h;;1H2/q-1;+1; |
| InChIKey | XDNFDCSEAAEHCT-UHFFFAOYSA-N |
| XLogP | -10.38 |
| TPSA | 100.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.01 |
| LogP ≤ 5 | -10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze potassium;iodate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;iodate;hydrate?
The IUPAC name of potassium;iodate;hydrate (CID 172718603) is potassium;iodate;hydrate.
What is the SMILES notation for potassium;iodate;hydrate?
The canonical SMILES for potassium;iodate;hydrate is O.[K+].[O-][I+2]([O-])[O-].
What is the InChIKey of potassium;iodate;hydrate?
The InChIKey is XDNFDCSEAAEHCT-UHFFFAOYSA-N. The full InChI is InChI=1S/IO3.K.H2O/c2-1(3)4;;/h;;1H2/q-1;+1;.
What are the key properties of potassium;iodate;hydrate?
potassium;iodate;hydrate has a molecular weight of 232.01 g/mol, XLogP of -10.38, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;iodate;hydrate is sourced from PubChem (CID 172718603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).