C14H26N4O5S — CID 172727257
1-[4-(dimethylamino)piperidin-1-yl]-3-(1-methylimidazol-2-yl)propan-1-one;sulfuric acid (PubChem CID 172727257) has the molecular formula C14H26N4O5S and a molecular weight of 362.45 g/mol. Its IUPAC name is 1-[4-(dimethylamino)piperidin-1-yl]-3-(1-methylimidazol-2-yl)propan-1-one;sulfuric acid.
| Compound Name | 1-[4-(dimethylamino)piperidin-1-yl]-3-(1-methylimidazol-2-yl)propan-1-one;sulfuric acid |
|---|---|
| PubChem CID | 172727257 |
| Molecular Formula | C14H26N4O5S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-[4-(dimethylamino)piperidin-1-yl]-3-(1-methylimidazol-2-yl)propan-1-one;sulfuric acid |
| SMILES | CN(C)C1CCN(C(=O)CCc2nccn2C)CC1.O=S(=O)(O)O |
| InChI | InChI=1S/C14H24N4O.H2O4S/c1-16(2)12-6-9-18(10-7-12)14(19)5-4-13-15-8-11-17(13)3;1-5(2,3)4/h8,11-12H,4-7,9-10H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | HHTSVMJBDNANPT-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|