C19H33ClN4O3 — CID 121452464
butyl 2-[2-[3-[4-(dimethylamino)piperidin-1-yl]-3-oxopropyl]imidazol-1-yl]acetate;hydrochloride (PubChem CID 121452464) has the molecular formula C19H33ClN4O3 and a molecular weight of 400.95 g/mol. Its IUPAC name is butyl 2-[2-[3-[4-(dimethylamino)piperidin-1-yl]-3-oxopropyl]imidazol-1-yl]acetate;hydrochloride.
| Compound Name | butyl 2-[2-[3-[4-(dimethylamino)piperidin-1-yl]-3-oxopropyl]imidazol-1-yl]acetate;hydrochloride |
|---|---|
| PubChem CID | 121452464 |
| Molecular Formula | C19H33ClN4O3 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | butyl 2-[2-[3-[4-(dimethylamino)piperidin-1-yl]-3-oxopropyl]imidazol-1-yl]acetate;hydrochloride |
| SMILES | CCCCOC(=O)Cn1ccnc1CCC(=O)N1CCC(N(C)C)CC1.Cl |
| InChI | InChI=1S/C19H32N4O3.ClH/c1-4-5-14-26-19(25)15-23-13-10-20-17(23)6-7-18(24)22-11-8-16(9-12-22)21(2)3;/h10,13,16H,4-9,11-12,14-15H2,1-3H3;1H |
| InChIKey | OJKRQBKTOSOGPS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|