C16H13Cl2Zr — CID 172728254
1-(4-methylcyclopenta-1,4-dien-1-yl)naphthalene;zirconium(3+);dichloride (PubChem CID 172728254) has the molecular formula C16H13Cl2Zr and a molecular weight of 367.41 g/mol. Its IUPAC name is 1-(4-methylcyclopenta-1,4-dien-1-yl)naphthalene;zirconium(3+);dichloride.
| Compound Name | 1-(4-methylcyclopenta-1,4-dien-1-yl)naphthalene;zirconium(3+);dichloride |
|---|---|
| PubChem CID | 172728254 |
| Molecular Formula | C16H13Cl2Zr |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 364.94 |
| IUPAC Name | 1-(4-methylcyclopenta-1,4-dien-1-yl)naphthalene;zirconium(3+);dichloride |
| SMILES | Cc1cc(-c2cccc3ccccc23)c[cH-]1.[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C16H13.2ClH.Zr/c1-12-9-10-14(11-12)16-8-4-6-13-5-2-3-7-15(13)16;;;/h2-11H,1H3;2*1H;/q-1;;;+3/p-2 |
| InChIKey | JTMNPDPIAYXLEF-UHFFFAOYSA-L |
| XLogP | -1.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|