C34H32Cl2SiZr-2 — CID 154419868
dichloro(dimethylsilylidene)zirconium;bis(1-(4-methylcyclopenta-1,4-dien-1-yl)naphthalene) (PubChem CID 154419868) has the molecular formula C34H32Cl2SiZr-2 and a molecular weight of 630.85 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(1-(4-methylcyclopenta-1,4-dien-1-yl)naphthalene).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(1-(4-methylcyclopenta-1,4-dien-1-yl)naphthalene) |
|---|---|
| PubChem CID | 154419868 |
| Molecular Formula | C34H32Cl2SiZr-2 |
| Molecular Weight | 630.85 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(1-(4-methylcyclopenta-1,4-dien-1-yl)naphthalene) |
| SMILES | C[Si](C)=[Zr](Cl)Cl.Cc1cc(-c2cccc3ccccc23)c[cH-]1.Cc1cc(-c2cccc3ccccc23)c[cH-]1 |
| InChI | InChI=1S/2C16H13.C2H6Si.2ClH.Zr/c2*1-12-9-10-14(11-12)16-8-4-6-13-5-2-3-7-15(13)16;1-3-2;;;/h2*2-11H,1H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | GGXPYNBJPHVZOC-UHFFFAOYSA-L |
| XLogP | 11.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.85 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|