C32H28Cl2SiZr-2 — CID 173268351
dichloro(dimethylsilylidene)zirconium;2,4-diphenyl-1H-inden-1-ide;1H-inden-1-ide (PubChem CID 173268351) has the molecular formula C32H28Cl2SiZr-2 and a molecular weight of 602.79 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;2,4-diphenyl-1H-inden-1-ide;1H-inden-1-ide.
| Compound Name | dichloro(dimethylsilylidene)zirconium;2,4-diphenyl-1H-inden-1-ide;1H-inden-1-ide |
|---|---|
| PubChem CID | 173268351 |
| Molecular Formula | C32H28Cl2SiZr-2 |
| Molecular Weight | 602.79 g/mol |
| Exact Mass | 600.04 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;2,4-diphenyl-1H-inden-1-ide;1H-inden-1-ide |
| SMILES | C[Si](C)=[Zr](Cl)Cl.c1ccc(-c2cc3c(-c4ccccc4)cccc3[cH-]2)cc1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C21H15.C9H7.C2H6Si.2ClH.Zr/c1-3-8-16(9-4-1)19-14-18-12-7-13-20(21(18)15-19)17-10-5-2-6-11-17;1-2-5-9-7-3-6-8(9)4-1;1-3-2;;;/h1-15H;1-7H;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | OWONZPDEJRTQEW-UHFFFAOYSA-L |
| XLogP | 10.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.79 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|