About benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide
benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide (PubChem CID 173081477) has the molecular formula C41H30Cl2Zr-2
and a molecular weight of 684.82 g/mol. Its IUPAC name is benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide |
| PubChem CID | 173081477 |
| Molecular Formula | C41H30Cl2Zr-2 |
| Molecular Weight | 684.82 g/mol |
| Exact Mass | 682.08 |
| IUPAC Name | benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide |
| SMILES | Cl[Zr](Cl)=C(c1ccccc1)c1ccccc1.c1ccc(-c2cccc3cc[cH-]c23)cc1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C15H11.C13H9.C13H10.2ClH.Zr/c1-2-6-12(7-3-1)14-10-4-8-13-9-5-11-15(13)14;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;;/h1-11H;1-9H;1-10H;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | OIIUFJQXPHOAQT-UHFFFAOYSA-L |
| XLogP | 12.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 684.82 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide?
The IUPAC name of benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide (CID 173081477) is benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide.
What is the SMILES notation for benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide?
The canonical SMILES for benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide is Cl[Zr](Cl)=C(c1ccccc1)c1ccccc1.c1ccc(-c2cccc3cc[cH-]c23)cc1.c1ccc2c(c1)[cH-]c1ccccc12.
What is the InChIKey of benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide?
The InChIKey is OIIUFJQXPHOAQT-UHFFFAOYSA-L. The full InChI is InChI=1S/C15H11.C13H9.C13H10.2ClH.Zr/c1-2-6-12(7-3-1)14-10-4-8-13-9-5-11-15(13)14;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;;;/h1-11H;1-9H;1-10H;2*1H;/q2*-1;;;;+2/p-2.
What are the key properties of benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide?
benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide has a molecular weight of 684.82 g/mol, XLogP of 12.12, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylidene(dichloro)zirconium;9H-fluoren-9-ide;7-phenyl-1H-inden-1-ide is sourced from PubChem (CID 173081477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).