C31H30Cl2Zr-2 — CID 154419546
benzhydrylidene(dichloro)zirconium;1,2-diethylcyclopenta-1,3-diene;1H-inden-1-ide (PubChem CID 154419546) has the molecular formula C31H30Cl2Zr-2 and a molecular weight of 564.71 g/mol. Its IUPAC name is benzhydrylidene(dichloro)zirconium;1,2-diethylcyclopenta-1,3-diene;1H-inden-1-ide.
| Compound Name | benzhydrylidene(dichloro)zirconium;1,2-diethylcyclopenta-1,3-diene;1H-inden-1-ide |
|---|---|
| PubChem CID | 154419546 |
| Molecular Formula | C31H30Cl2Zr-2 |
| Molecular Weight | 564.71 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | benzhydrylidene(dichloro)zirconium;1,2-diethylcyclopenta-1,3-diene;1H-inden-1-ide |
| SMILES | CCc1cc[cH-]c1CC.Cl[Zr](Cl)=C(c1ccccc1)c1ccccc1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C13H10.C9H7.C9H13.2ClH.Zr/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-5-9-7-3-6-8(9)4-1;1-3-8-6-5-7-9(8)4-2;;;/h1-10H;1-7H;5-7H,3-4H2,1-2H3;2*1H;/q;2*-1;;;+2/p-2 |
| InChIKey | VKWPXPBXGHWADC-UHFFFAOYSA-L |
| XLogP | 9.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.71 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|