C24H37O6Zr- — CID 173215321
tris(2,2-dimethylpropanoic acid);1H-inden-1-ide;zirconium (PubChem CID 173215321) has the molecular formula C24H37O6Zr- and a molecular weight of 512.78 g/mol. Its IUPAC name is tris(2,2-dimethylpropanoic acid);1H-inden-1-ide;zirconium.
| Compound Name | tris(2,2-dimethylpropanoic acid);1H-inden-1-ide;zirconium |
|---|---|
| PubChem CID | 173215321 |
| Molecular Formula | C24H37O6Zr- |
| Molecular Weight | 512.78 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | tris(2,2-dimethylpropanoic acid);1H-inden-1-ide;zirconium |
| SMILES | CC(C)(C)C(=O)O.CC(C)(C)C(=O)O.CC(C)(C)C(=O)O.[Zr].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.3C5H10O2.Zr/c1-2-5-9-7-3-6-8(9)4-1;3*1-5(2,3)4(6)7;/h1-7H;3*1-3H3,(H,6,7);/q-1;;;; |
| InChIKey | JGELGYGOBGXSIT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.78 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|