C24H34O3Zr — CID 174466791
tris(2,2-dimethylpropan-1-one);1H-inden-1-ide;zirconium(4+) (PubChem CID 174466791) has the molecular formula C24H34O3Zr and a molecular weight of 461.76 g/mol. Its IUPAC name is tris(2,2-dimethylpropan-1-one);1H-inden-1-ide;zirconium(4+).
| Compound Name | tris(2,2-dimethylpropan-1-one);1H-inden-1-ide;zirconium(4+) |
|---|---|
| PubChem CID | 174466791 |
| Molecular Formula | C24H34O3Zr |
| Molecular Weight | 461.76 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | tris(2,2-dimethylpropan-1-one);1H-inden-1-ide;zirconium(4+) |
| SMILES | CC(C)(C)[C-]=O.CC(C)(C)[C-]=O.CC(C)(C)[C-]=O.[Zr+4].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.3C5H9O.Zr/c1-2-5-9-7-3-6-8(9)4-1;3*1-5(2,3)4-6;/h1-7H;3*1-3H3;/q4*-1;+4 |
| InChIKey | BMHKYLRMRJARBF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.76 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|