C37H30Cl2Zr-2 — CID 173081411
benzhydrylidene(dichloro)zirconium;2,7-dimethyl-9H-fluoren-9-ide;1H-inden-1-ide (PubChem CID 173081411) has the molecular formula C37H30Cl2Zr-2 and a molecular weight of 636.78 g/mol. Its IUPAC name is benzhydrylidene(dichloro)zirconium;2,7-dimethyl-9H-fluoren-9-ide;1H-inden-1-ide.
| Compound Name | benzhydrylidene(dichloro)zirconium;2,7-dimethyl-9H-fluoren-9-ide;1H-inden-1-ide |
|---|---|
| PubChem CID | 173081411 |
| Molecular Formula | C37H30Cl2Zr-2 |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | benzhydrylidene(dichloro)zirconium;2,7-dimethyl-9H-fluoren-9-ide;1H-inden-1-ide |
| SMILES | Cc1ccc2c(c1)[cH-]c1cc(C)ccc12.Cl[Zr](Cl)=C(c1ccccc1)c1ccccc1.c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C15H13.C13H10.C9H7.2ClH.Zr/c1-10-3-5-14-12(7-10)9-13-8-11(2)4-6-15(13)14;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-2-5-9-7-3-6-8(9)4-1;;;/h3-9H,1-2H3;1-10H;1-7H;2*1H;/q-1;;-1;;;+2/p-2 |
| InChIKey | CQWBMZCWHYYDIT-UHFFFAOYSA-L |
| XLogP | 11.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|