About hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate)
hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate) (PubChem CID 160835500) has the molecular formula C33H28HfO6
and a molecular weight of 699.07 g/mol. Its IUPAC name is hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate).
Molecular Properties
| Compound Name | hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate) |
| PubChem CID | 160835500 |
| Molecular Formula | C33H28HfO6 |
| Molecular Weight | 699.07 g/mol |
| Exact Mass | 700.14 |
| IUPAC Name | hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate) |
| SMILES | Cc1ccc(C(=O)[O-])cc1.Cc1ccc(C(=O)[O-])cc1.Cc1ccc(C(=O)[O-])cc1.[Hf+4].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C9H7.3C8H8O2.Hf/c1-2-5-9-7-3-6-8(9)4-1;3*1-6-2-4-7(5-3-6)8(9)10;/h1-7H;3*2-5H,1H3,(H,9,10);/q-1;;;;+4/p-3 |
| InChIKey | SHIYHYYXBLOWHA-UHFFFAOYSA-K |
| XLogP | 3.63 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 699.07 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate)?
The IUPAC name of hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate) (CID 160835500) is hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate).
What is the SMILES notation for hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate)?
The canonical SMILES for hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate) is Cc1ccc(C(=O)[O-])cc1.Cc1ccc(C(=O)[O-])cc1.Cc1ccc(C(=O)[O-])cc1.[Hf+4].c1ccc2[cH-]ccc2c1.
What is the InChIKey of hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate)?
The InChIKey is SHIYHYYXBLOWHA-UHFFFAOYSA-K. The full InChI is InChI=1S/C9H7.3C8H8O2.Hf/c1-2-5-9-7-3-6-8(9)4-1;3*1-6-2-4-7(5-3-6)8(9)10;/h1-7H;3*2-5H,1H3,(H,9,10);/q-1;;;;+4/p-3.
What are the key properties of hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate)?
hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate) has a molecular weight of 699.07 g/mol, XLogP of 3.63, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hafnium(4+);1H-inden-1-ide;tris(4-methylbenzoate) is sourced from PubChem (CID 160835500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).