C45H46Cl2Zr-2 — CID 173081530
benzhydrylidene(dichloro)zirconium;2,7-ditert-butyl-9H-fluoren-9-ide;3,6-dimethyl-1H-inden-1-ide (PubChem CID 173081530) has the molecular formula C45H46Cl2Zr-2 and a molecular weight of 748.99 g/mol. Its IUPAC name is benzhydrylidene(dichloro)zirconium;2,7-ditert-butyl-9H-fluoren-9-ide;3,6-dimethyl-1H-inden-1-ide.
| Compound Name | benzhydrylidene(dichloro)zirconium;2,7-ditert-butyl-9H-fluoren-9-ide;3,6-dimethyl-1H-inden-1-ide |
|---|---|
| PubChem CID | 173081530 |
| Molecular Formula | C45H46Cl2Zr-2 |
| Molecular Weight | 748.99 g/mol |
| Exact Mass | 746.20 |
| IUPAC Name | benzhydrylidene(dichloro)zirconium;2,7-ditert-butyl-9H-fluoren-9-ide;3,6-dimethyl-1H-inden-1-ide |
| SMILES | CC(C)(C)c1ccc2c(c1)[cH-]c1cc(C(C)(C)C)ccc12.Cc1ccc2c(C)c[cH-]c2c1.Cl[Zr](Cl)=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25.C13H10.C11H11.2ClH.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-8-3-6-11-9(2)4-5-10(11)7-8;;;/h7-13H,1-6H3;1-10H;3-7H,1-2H3;2*1H;/q-1;;-1;;;+2/p-2 |
| InChIKey | UYLNBEQYDJTBQD-UHFFFAOYSA-L |
| XLogP | 13.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.99 |
| LogP ≤ 5 | 13.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|