C17H19Hf-3 — CID 173229354
carbanide;2,7-dimethyl-9H-fluoren-9-ide;hafnium (PubChem CID 173229354) has the molecular formula C17H19Hf-3 and a molecular weight of 401.83 g/mol. Its IUPAC name is carbanide;2,7-dimethyl-9H-fluoren-9-ide;hafnium.
| Compound Name | carbanide;2,7-dimethyl-9H-fluoren-9-ide;hafnium |
|---|---|
| PubChem CID | 173229354 |
| Molecular Formula | C17H19Hf-3 |
| Molecular Weight | 401.83 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | carbanide;2,7-dimethyl-9H-fluoren-9-ide;hafnium |
| SMILES | Cc1ccc2c(c1)[cH-]c1cc(C)ccc12.[CH3-].[CH3-].[Hf] |
| InChI | InChI=1S/C15H13.2CH3.Hf/c1-10-3-5-14-12(7-10)9-13-8-11(2)4-6-15(13)14;;;/h3-9H,1-2H3;2*1H3;/q3*-1; |
| InChIKey | UYUCDUYUMWCJNA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.83 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|