C37H30Zr — CID 173229693
benzhydrylidenezirconium(2+);6,7-dimethyl-1H-inden-1-ide;9H-fluoren-9-ide (PubChem CID 173229693) has the molecular formula C37H30Zr and a molecular weight of 565.87 g/mol. Its IUPAC name is benzhydrylidenezirconium(2+);6,7-dimethyl-1H-inden-1-ide;9H-fluoren-9-ide.
| Compound Name | benzhydrylidenezirconium(2+);6,7-dimethyl-1H-inden-1-ide;9H-fluoren-9-ide |
|---|---|
| PubChem CID | 173229693 |
| Molecular Formula | C37H30Zr |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | benzhydrylidenezirconium(2+);6,7-dimethyl-1H-inden-1-ide;9H-fluoren-9-ide |
| SMILES | Cc1ccc2cc[cH-]c2c1C.[Zr+2]=C(c1ccccc1)c1ccccc1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C13H10.C11H11.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-8-6-7-10-4-3-5-11(10)9(8)2;/h1-9H;1-10H;3-7H,1-2H3;/q-1;;-1;+2 |
| InChIKey | XHUUHUUKXWTMTC-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|