C15H13Li — CID 175514215
lithium 1,2-dimethyl-9H-fluoren-9-ide (PubChem CID 175514215) has the molecular formula C15H13Li and a molecular weight of 200.21 g/mol. Its IUPAC name is lithium 1,2-dimethyl-9H-fluoren-9-ide.
| Compound Name | lithium 1,2-dimethyl-9H-fluoren-9-ide |
|---|---|
| PubChem CID | 175514215 |
| Molecular Formula | C15H13Li |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | lithium 1,2-dimethyl-9H-fluoren-9-ide |
| SMILES | Cc1ccc2c([cH-]c3ccccc32)c1C.[Li+] |
| InChI | InChI=1S/C15H13.Li/c1-10-7-8-14-13-6-4-3-5-12(13)9-15(14)11(10)2;/h3-9H,1-2H3;/q-1;+1 |
| InChIKey | GMHPEMFMYVWWKC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|