C22H22Cl2Zr — CID 169048347
dichlorozirconium(2+);9H-fluoren-9-ide;1,2,3,4-tetramethylcyclopenta-1,3-diene (PubChem CID 169048347) has the molecular formula C22H22Cl2Zr and a molecular weight of 448.55 g/mol. Its IUPAC name is dichlorozirconium(2+);9H-fluoren-9-ide;1,2,3,4-tetramethylcyclopenta-1,3-diene.
| Compound Name | dichlorozirconium(2+);9H-fluoren-9-ide;1,2,3,4-tetramethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 169048347 |
| Molecular Formula | C22H22Cl2Zr |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 446.01 |
| IUPAC Name | dichlorozirconium(2+);9H-fluoren-9-ide;1,2,3,4-tetramethylcyclopenta-1,3-diene |
| SMILES | Cc1[cH-]c(C)c(C)c1C.Cl[Zr+2]Cl.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C9H13.2ClH.Zr/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-6-5-7(2)9(4)8(6)3;;;/h1-9H;5H,1-4H3;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | AJROKQSNTLOSTA-UHFFFAOYSA-L |
| XLogP | 7.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|