About 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+)
2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) (PubChem CID 161494511) has the molecular formula C20H20SiTi
and a molecular weight of 336.33 g/mol. Its IUPAC name is 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+).
Molecular Properties
| Compound Name | 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) |
| PubChem CID | 161494511 |
| Molecular Formula | C20H20SiTi |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) |
| SMILES | Cc1[cH-]c2ccccc2c1C.[SiH2]=[Ti+2].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C11H11.C9H7.H2Si.Ti/c1-8-7-10-5-3-4-6-11(10)9(8)2;1-2-5-9-7-3-6-8(9)4-1;;/h3-7H,1-2H3;1-7H;1H2;/q2*-1;;+2 |
| InChIKey | OAIALZXJTNPOBF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+)?
The IUPAC name of 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) (CID 161494511) is 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+).
What is the SMILES notation for 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+)?
The canonical SMILES for 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) is Cc1[cH-]c2ccccc2c1C.[SiH2]=[Ti+2].c1ccc2[cH-]ccc2c1.
What is the InChIKey of 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+)?
The InChIKey is OAIALZXJTNPOBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11.C9H7.H2Si.Ti/c1-8-7-10-5-3-4-6-11(10)9(8)2;1-2-5-9-7-3-6-8(9)4-1;;/h3-7H,1-2H3;1-7H;1H2;/q2*-1;;+2.
What are the key properties of 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+)?
2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) has a molecular weight of 336.33 g/mol, XLogP of 4.82, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) is sourced from PubChem (CID 161494511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).