C20H20SiTi — CID 161494511
2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) (PubChem CID 161494511) has the molecular formula C20H20SiTi and a molecular weight of 336.33 g/mol. Its IUPAC name is 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+).
| Compound Name | 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) |
|---|---|
| PubChem CID | 161494511 |
| Molecular Formula | C20H20SiTi |
| Molecular Weight | 336.33 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 2,3-dimethyl-1H-inden-1-ide;1H-inden-1-ide;silylidenetitanium(2+) |
| SMILES | Cc1[cH-]c2ccccc2c1C.[SiH2]=[Ti+2].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C11H11.C9H7.H2Si.Ti/c1-8-7-10-5-3-4-6-11(10)9(8)2;1-2-5-9-7-3-6-8(9)4-1;;/h3-7H,1-2H3;1-7H;1H2;/q2*-1;;+2 |
| InChIKey | OAIALZXJTNPOBF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|