About 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+)
1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) (PubChem CID 87828894) has the molecular formula C25H21PZr
and a molecular weight of 443.64 g/mol. Its IUPAC name is 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+).
Molecular Properties
| Compound Name | 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) |
| PubChem CID | 87828894 |
| Molecular Formula | C25H21PZr |
| Molecular Weight | 443.64 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) |
| SMILES | Cc1[cH-]c2ccccc2c1Pc1ccccc1.[Zr+2].c1ccc2[cH-]ccc2c1 |
| InChI | InChI=1S/C16H14P.C9H7.Zr/c1-12-11-13-7-5-6-10-15(13)16(12)17-14-8-3-2-4-9-14;1-2-5-9-7-3-6-8(9)4-1;/h2-11,17H,1H3;1-7H;/q2*-1;+2 |
| InChIKey | VKQPOIXMRWLTIK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.64 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+)?
The IUPAC name of 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) (CID 87828894) is 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+).
What is the SMILES notation for 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+)?
The canonical SMILES for 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) is Cc1[cH-]c2ccccc2c1Pc1ccccc1.[Zr+2].c1ccc2[cH-]ccc2c1.
What is the InChIKey of 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+)?
The InChIKey is VKQPOIXMRWLTIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14P.C9H7.Zr/c1-12-11-13-7-5-6-10-15(13)16(12)17-14-8-3-2-4-9-14;1-2-5-9-7-3-6-8(9)4-1;/h2-11,17H,1H3;1-7H;/q2*-1;+2.
What are the key properties of 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+)?
1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) has a molecular weight of 443.64 g/mol, XLogP of 6.05, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-1-ide;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;zirconium(2+) is sourced from PubChem (CID 87828894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).