C21H19PTi — CID 87830483
cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) (PubChem CID 87830483) has the molecular formula C21H19PTi and a molecular weight of 350.22 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+).
| Compound Name | cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) |
|---|---|
| PubChem CID | 87830483 |
| Molecular Formula | C21H19PTi |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) |
| SMILES | Cc1[cH-]c2ccccc2c1Pc1ccccc1.[C-]1=CC=CC1.[Ti+2] |
| InChI | InChI=1S/C16H14P.C5H5.Ti/c1-12-11-13-7-5-6-10-15(13)16(12)17-14-8-3-2-4-9-14;1-2-4-5-3-1;/h2-11,17H,1H3;1-3H,4H2;/q2*-1;+2 |
| InChIKey | ZCFXSHOHDBYENH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|