About cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+)
cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) (PubChem CID 87830483) has the molecular formula C21H19PTi
and a molecular weight of 350.22 g/mol. Its IUPAC name is cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+).
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) |
| PubChem CID | 87830483 |
| Molecular Formula | C21H19PTi |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) |
| SMILES | Cc1[cH-]c2ccccc2c1Pc1ccccc1.[C-]1=CC=CC1.[Ti+2] |
| InChI | InChI=1S/C16H14P.C5H5.Ti/c1-12-11-13-7-5-6-10-15(13)16(12)17-14-8-3-2-4-9-14;1-2-4-5-3-1;/h2-11,17H,1H3;1-3H,4H2;/q2*-1;+2 |
| InChIKey | ZCFXSHOHDBYENH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+)?
The IUPAC name of cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) (CID 87830483) is cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+).
What is the SMILES notation for cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+)?
The canonical SMILES for cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) is Cc1[cH-]c2ccccc2c1Pc1ccccc1.[C-]1=CC=CC1.[Ti+2].
What is the InChIKey of cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+)?
The InChIKey is ZCFXSHOHDBYENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14P.C5H5.Ti/c1-12-11-13-7-5-6-10-15(13)16(12)17-14-8-3-2-4-9-14;1-2-4-5-3-1;/h2-11,17H,1H3;1-3H,4H2;/q2*-1;+2.
What are the key properties of cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+)?
cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) has a molecular weight of 350.22 g/mol, XLogP of 4.80, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;(2-methyl-3H-inden-3-id-1-yl)-phenylphosphane;titanium(2+) is sourced from PubChem (CID 87830483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).