C20H20Cl2HfSi-2 — CID 174047741
cyclopenta-1,3-diene;dichloro(dimethylsilylidene)hafnium;9H-fluoren-9-ide (PubChem CID 174047741) has the molecular formula C20H20Cl2HfSi-2 and a molecular weight of 537.86 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichloro(dimethylsilylidene)hafnium;9H-fluoren-9-ide.
| Compound Name | cyclopenta-1,3-diene;dichloro(dimethylsilylidene)hafnium;9H-fluoren-9-ide |
|---|---|
| PubChem CID | 174047741 |
| Molecular Formula | C20H20Cl2HfSi-2 |
| Molecular Weight | 537.86 g/mol |
| Exact Mass | 538.02 |
| IUPAC Name | cyclopenta-1,3-diene;dichloro(dimethylsilylidene)hafnium;9H-fluoren-9-ide |
| SMILES | C[Si](C)=[Hf](Cl)Cl.c1cc[cH-]c1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C5H5.C2H6Si.2ClH.Hf/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-4-5-3-1;1-3-2;;;/h1-9H;1-5H;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | ADBDZVZJBDEXET-UHFFFAOYSA-L |
| XLogP | 7.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.86 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|