About cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide
cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide (PubChem CID 174047756) has the molecular formula C19H16Cl2Hf-2
and a molecular weight of 493.73 g/mol. Its IUPAC name is cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide |
| PubChem CID | 174047756 |
| Molecular Formula | C19H16Cl2Hf-2 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide |
| SMILES | C=[Hf](Cl)Cl.c1cc[cH-]c1.c1ccc2c(c1)[cH-]c1ccccc12 |
| InChI | InChI=1S/C13H9.C5H5.CH2.2ClH.Hf/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-4-5-3-1;;;;/h1-9H;1-5H;1H2;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | WHKCREAIERGROI-UHFFFAOYSA-L |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide?
The IUPAC name of cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide (CID 174047756) is cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide.
What is the SMILES notation for cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide?
The canonical SMILES for cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide is C=[Hf](Cl)Cl.c1cc[cH-]c1.c1ccc2c(c1)[cH-]c1ccccc12.
What is the InChIKey of cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide?
The InChIKey is WHKCREAIERGROI-UHFFFAOYSA-L. The full InChI is InChI=1S/C13H9.C5H5.CH2.2ClH.Hf/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2-4-5-3-1;;;;/h1-9H;1-5H;1H2;2*1H;/q2*-1;;;;+2/p-2.
What are the key properties of cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide?
cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide has a molecular weight of 493.73 g/mol, XLogP of 6.46, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;dichloro(methylidene)hafnium;9H-fluoren-9-ide is sourced from PubChem (CID 174047756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).