C27H32Cl2SiZr-2 — CID 154075918
dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide;1,2,3,4-tetramethylcyclopenta-1,3-diene (PubChem CID 154075918) has the molecular formula C27H32Cl2SiZr-2 and a molecular weight of 546.77 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide;1,2,3,4-tetramethylcyclopenta-1,3-diene.
| Compound Name | dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide;1,2,3,4-tetramethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 154075918 |
| Molecular Formula | C27H32Cl2SiZr-2 |
| Molecular Weight | 546.77 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide;1,2,3,4-tetramethylcyclopenta-1,3-diene |
| SMILES | C[Si](C)=[Zr](Cl)Cl.Cc1[cH-]c(C)c(C)c1C.Cc1cc2c(-c3ccccc3)cccc2[cH-]1 |
| InChI | InChI=1S/C16H13.C9H13.C2H6Si.2ClH.Zr/c1-12-10-14-8-5-9-15(16(14)11-12)13-6-3-2-4-7-13;1-6-5-7(2)9(4)8(6)3;1-3-2;;;/h2-11H,1H3;5H,1-4H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | JHLSVTKUFDVHPC-UHFFFAOYSA-L |
| XLogP | 9.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.77 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|