About dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide)
dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) (PubChem CID 87410533) has the molecular formula C24H28Cl2SiZr-2
and a molecular weight of 506.70 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide).
Molecular Properties
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) |
| PubChem CID | 87410533 |
| Molecular Formula | C24H28Cl2SiZr-2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) |
| SMILES | C[Si](C)=[Zr](Cl)Cl.Cc1cc2c(C)cccc2[cH-]1.Cc1cc2c(C)cccc2[cH-]1 |
| InChI | InChI=1S/2C11H11.C2H6Si.2ClH.Zr/c2*1-8-6-10-5-3-4-9(2)11(10)7-8;1-3-2;;;/h2*3-7H,1-2H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | FQSGHQHECPWPER-UHFFFAOYSA-L |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide)?
The IUPAC name of dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) (CID 87410533) is dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide).
What is the SMILES notation for dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide)?
The canonical SMILES for dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) is C[Si](C)=[Zr](Cl)Cl.Cc1cc2c(C)cccc2[cH-]1.Cc1cc2c(C)cccc2[cH-]1.
What is the InChIKey of dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide)?
The InChIKey is FQSGHQHECPWPER-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H11.C2H6Si.2ClH.Zr/c2*1-8-6-10-5-3-4-9(2)11(10)7-8;1-3-2;;;/h2*3-7H,1-2H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2.
What are the key properties of dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide)?
dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) has a molecular weight of 506.70 g/mol, XLogP of 8.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) is sourced from PubChem (CID 87410533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).