C24H28Cl2SiZr-2 — CID 87410533
dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) (PubChem CID 87410533) has the molecular formula C24H28Cl2SiZr-2 and a molecular weight of 506.70 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) |
|---|---|
| PubChem CID | 87410533 |
| Molecular Formula | C24H28Cl2SiZr-2 |
| Molecular Weight | 506.70 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-1H-inden-1-ide) |
| SMILES | C[Si](C)=[Zr](Cl)Cl.Cc1cc2c(C)cccc2[cH-]1.Cc1cc2c(C)cccc2[cH-]1 |
| InChI | InChI=1S/2C11H11.C2H6Si.2ClH.Zr/c2*1-8-6-10-5-3-4-9(2)11(10)7-8;1-3-2;;;/h2*3-7H,1-2H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | FQSGHQHECPWPER-UHFFFAOYSA-L |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.70 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|