C30H40Cl2SiZr-2 — CID 173326537
dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-6-propyl-1H-inden-1-ide) (PubChem CID 173326537) has the molecular formula C30H40Cl2SiZr-2 and a molecular weight of 590.87 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-6-propyl-1H-inden-1-ide).
| Compound Name | dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-6-propyl-1H-inden-1-ide) |
|---|---|
| PubChem CID | 173326537 |
| Molecular Formula | C30H40Cl2SiZr-2 |
| Molecular Weight | 590.87 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;bis(2,4-dimethyl-6-propyl-1H-inden-1-ide) |
| SMILES | CCCc1cc(C)c2cc(C)[cH-]c2c1.CCCc1cc(C)c2cc(C)[cH-]c2c1.C[Si](C)=[Zr](Cl)Cl |
| InChI | InChI=1S/2C14H17.C2H6Si.2ClH.Zr/c2*1-4-5-12-8-11(3)14-7-10(2)6-13(14)9-12;1-3-2;;;/h2*6-9H,4-5H2,1-3H3;1-2H3;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | AOQVHNSWAPAXJW-UHFFFAOYSA-L |
| XLogP | 10.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.87 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|