C24H26Zr — CID 142685568
bis(2,4,6-trimethyl-1H-inden-1-ide);zirconium(2+) (PubChem CID 142685568) has the molecular formula C24H26Zr and a molecular weight of 405.70 g/mol. Its IUPAC name is bis(2,4,6-trimethyl-1H-inden-1-ide);zirconium(2+).
| Compound Name | bis(2,4,6-trimethyl-1H-inden-1-ide);zirconium(2+) |
|---|---|
| PubChem CID | 142685568 |
| Molecular Formula | C24H26Zr |
| Molecular Weight | 405.70 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | bis(2,4,6-trimethyl-1H-inden-1-ide);zirconium(2+) |
| SMILES | Cc1cc(C)c2cc(C)[cH-]c2c1.Cc1cc(C)c2cc(C)[cH-]c2c1.[Zr+2] |
| InChI | InChI=1S/2C12H13.Zr/c2*1-8-4-10(3)12-7-9(2)6-11(12)5-8;/h2*4-7H,1-3H3;/q2*-1;+2 |
| InChIKey | PJJWXJIREZQKJU-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.70 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|