C18H19Cl2Zr- — CID 175331642
4-(3,5-dimethylphenyl)-2-methyl-1H-inden-1-ide;zirconium;dihydrochloride (PubChem CID 175331642) has the molecular formula C18H19Cl2Zr- and a molecular weight of 397.48 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-2-methyl-1H-inden-1-ide;zirconium;dihydrochloride.
| Compound Name | 4-(3,5-dimethylphenyl)-2-methyl-1H-inden-1-ide;zirconium;dihydrochloride |
|---|---|
| PubChem CID | 175331642 |
| Molecular Formula | C18H19Cl2Zr- |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-2-methyl-1H-inden-1-ide;zirconium;dihydrochloride |
| SMILES | Cc1cc(C)cc(-c2cccc3[cH-]c(C)cc23)c1.Cl.Cl.[Zr] |
| InChI | InChI=1S/C18H17.2ClH.Zr/c1-12-7-13(2)10-16(9-12)17-6-4-5-15-8-14(3)11-18(15)17;;;/h4-11H,1-3H3;2*1H;/q-1;;; |
| InChIKey | PWSDFUIGDOVWGE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|