C24H29Zr- — CID 154511524
4-(3,5-ditert-butylphenyl)-2-methyl-1H-inden-1-ide;zirconium (PubChem CID 154511524) has the molecular formula C24H29Zr- and a molecular weight of 408.72 g/mol. Its IUPAC name is 4-(3,5-ditert-butylphenyl)-2-methyl-1H-inden-1-ide;zirconium.
| Compound Name | 4-(3,5-ditert-butylphenyl)-2-methyl-1H-inden-1-ide;zirconium |
|---|---|
| PubChem CID | 154511524 |
| Molecular Formula | C24H29Zr- |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-(3,5-ditert-butylphenyl)-2-methyl-1H-inden-1-ide;zirconium |
| SMILES | Cc1cc2c(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cccc2[cH-]1.[Zr] |
| InChI | InChI=1S/C24H29.Zr/c1-16-11-17-9-8-10-21(22(17)12-16)18-13-19(23(2,3)4)15-20(14-18)24(5,6)7;/h8-15H,1-7H3;/q-1; |
| InChIKey | MCZNJKKBNYKTAR-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|